C18H20N2O3S — CID 122078651
4-[(3-thiophen-2-ylphenyl)carbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 122078651) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is 4-[(3-thiophen-2-ylphenyl)carbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(3-thiophen-2-ylphenyl)carbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122078651 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 4-[(3-thiophen-2-ylphenyl)carbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(Nc1cccc(-c2cccs2)c1)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C18H20N2O3S/c21-17(22)12-6-8-14(9-7-12)19-18(23)20-15-4-1-3-13(11-15)16-5-2-10-24-16/h1-5,10-12,14H,6-9H2,(H,21,22)(H2,19,20,23) |
| InChIKey | VKOLJBHPZGOORW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |