C12H16N2O3S — CID 66355665
4-(thiophen-3-ylcarbamoylamino)cyclohexane-1-carboxylic acid (PubChem CID 66355665) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is 4-(thiophen-3-ylcarbamoylamino)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(thiophen-3-ylcarbamoylamino)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 66355665 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 4-(thiophen-3-ylcarbamoylamino)cyclohexane-1-carboxylic acid |
| SMILES | O=C(Nc1ccsc1)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C12H16N2O3S/c15-11(16)8-1-3-9(4-2-8)13-12(17)14-10-5-6-18-7-10/h5-9H,1-4H2,(H,15,16)(H2,13,14,17) |
| InChIKey | OUDPOEVIENIIJO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |