C15H18F2N2O3 — CID 122078754
4-[[3-(difluoromethyl)phenyl]carbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 122078754) has the molecular formula C15H18F2N2O3 and a molecular weight of 312.32 g/mol. Its IUPAC name is 4-[[3-(difluoromethyl)phenyl]carbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[3-(difluoromethyl)phenyl]carbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122078754 |
| Molecular Formula | C15H18F2N2O3 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 4-[[3-(difluoromethyl)phenyl]carbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(Nc1cccc(C(F)F)c1)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C15H18F2N2O3/c16-13(17)10-2-1-3-12(8-10)19-15(22)18-11-6-4-9(5-7-11)14(20)21/h1-3,8-9,11,13H,4-7H2,(H,20,21)(H2,18,19,22) |
| InChIKey | HQPIEWHIQGJYAT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |