C15H16N2O3S2 — CID 95303669
1-[(3S)-1,1-dioxothiolan-3-yl]-3-(3-thiophen-2-ylphenyl)urea (PubChem CID 95303669) has the molecular formula C15H16N2O3S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(3-thiophen-2-ylphenyl)urea.
| Compound Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(3-thiophen-2-ylphenyl)urea |
|---|---|
| PubChem CID | 95303669 |
| Molecular Formula | C15H16N2O3S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(3-thiophen-2-ylphenyl)urea |
| SMILES | O=C(Nc1cccc(-c2cccs2)c1)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H16N2O3S2/c18-15(17-13-6-8-22(19,20)10-13)16-12-4-1-3-11(9-12)14-5-2-7-21-14/h1-5,7,9,13H,6,8,10H2,(H2,16,17,18)/t13-/m0/s1 |
| InChIKey | KJFNIQNJOFRVQH-ZDUSSCGKSA-N |
| XLogP | 2.72 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |