C12H12F2N2O5S — CID 95145687
1-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-[(3R)-1,1-dioxothiolan-3-yl]urea (PubChem CID 95145687) has the molecular formula C12H12F2N2O5S and a molecular weight of 334.30 g/mol. Its IUPAC name is 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-[(3R)-1,1-dioxothiolan-3-yl]urea.
| Compound Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-[(3R)-1,1-dioxothiolan-3-yl]urea |
|---|---|
| PubChem CID | 95145687 |
| Molecular Formula | C12H12F2N2O5S |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-[(3R)-1,1-dioxothiolan-3-yl]urea |
| SMILES | O=C(Nc1ccc2c(c1)OC(F)(F)O2)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H12F2N2O5S/c13-12(14)20-9-2-1-7(5-10(9)21-12)15-11(17)16-8-3-4-22(18,19)6-8/h1-2,5,8H,3-4,6H2,(H2,15,16,17)/t8-/m1/s1 |
| InChIKey | NZHUQNMVWGJLNT-MRVPVSSYSA-N |
| XLogP | 1.32 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |