C13H15N3O3S2 — CID 129370179
1-[(3R)-1,1-dioxothiolan-3-yl]-3-(2-methyl-1,3-benzothiazol-6-yl)urea (PubChem CID 129370179) has the molecular formula C13H15N3O3S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(2-methyl-1,3-benzothiazol-6-yl)urea.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(2-methyl-1,3-benzothiazol-6-yl)urea |
|---|---|
| PubChem CID | 129370179 |
| Molecular Formula | C13H15N3O3S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(2-methyl-1,3-benzothiazol-6-yl)urea |
| SMILES | Cc1nc2ccc(NC(=O)N[C@@H]3CCS(=O)(=O)C3)cc2s1 |
| InChI | InChI=1S/C13H15N3O3S2/c1-8-14-11-3-2-9(6-12(11)20-8)15-13(17)16-10-4-5-21(18,19)7-10/h2-3,6,10H,4-5,7H2,1H3,(H2,15,16,17)/t10-/m1/s1 |
| InChIKey | MLQWMGLXAZXOGX-SNVBAGLBSA-N |
| XLogP | 1.91 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |