C14H19N3O4S — CID 102566392
N-[4-[(1,1-dioxothiolan-3-yl)carbamoylamino]phenyl]propanamide (PubChem CID 102566392) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is N-[4-[(1,1-dioxothiolan-3-yl)carbamoylamino]phenyl]propanamide.
| Compound Name | N-[4-[(1,1-dioxothiolan-3-yl)carbamoylamino]phenyl]propanamide |
|---|---|
| PubChem CID | 102566392 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-[4-[(1,1-dioxothiolan-3-yl)carbamoylamino]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(NC(=O)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C14H19N3O4S/c1-2-13(18)15-10-3-5-11(6-4-10)16-14(19)17-12-7-8-22(20,21)9-12/h3-6,12H,2,7-9H2,1H3,(H,15,18)(H2,16,17,19) |
| InChIKey | MKTDWRXIYVOXSB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |