C28H26F4N4O8S2 — CID 99648184
1-[(3R)-1,1-dioxothiolan-3-yl]-3-[4-[4-[4-[[(3R)-1,1-dioxothiolan-3-yl]carbamoylamino]phenoxy]-2,3,5,6-tetrafluorophenoxy]phenyl]urea (PubChem CID 99648184) has the molecular formula C28H26F4N4O8S2 and a molecular weight of 686.66 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[4-[4-[4-[[(3R)-1,1-dioxothiolan-3-yl]carbamoylamino]phenoxy]-2,3,5,6-tetrafluorophenoxy]phenyl]urea.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[4-[4-[4-[[(3R)-1,1-dioxothiolan-3-yl]carbamoylamino]phenoxy]-2,3,5,6-tetrafluorophenoxy]phenyl]urea |
|---|---|
| PubChem CID | 99648184 |
| Molecular Formula | C28H26F4N4O8S2 |
| Molecular Weight | 686.66 g/mol |
| Exact Mass | 686.11 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[4-[4-[4-[[(3R)-1,1-dioxothiolan-3-yl]carbamoylamino]phenoxy]-2,3,5,6-tetrafluorophenoxy]phenyl]urea |
| SMILES | O=C(Nc1ccc(Oc2c(F)c(F)c(Oc3ccc(NC(=O)N[C@@H]4CCS(=O)(=O)C4)cc3)c(F)c2F)cc1)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C28H26F4N4O8S2/c29-21-23(31)26(44-20-7-3-16(4-8-20)34-28(38)36-18-10-12-46(41,42)14-18)24(32)22(30)25(21)43-19-5-1-15(2-6-19)33-27(37)35-17-9-11-45(39,40)13-17/h1-8,17-18H,9-14H2,(H2,33,35,37)(H2,34,36,38)/t17-,18-/m1/s1 |
| InChIKey | DAXKSXFXJRMVSL-QZTJIDSGSA-N |
| XLogP | 4.44 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.66 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|