C13H16N2O5S — CID 108502630
N-(1,1-dioxothiolan-3-yl)-N'-(4-methoxyphenyl)oxamide (PubChem CID 108502630) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N'-(4-methoxyphenyl)oxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N'-(4-methoxyphenyl)oxamide |
|---|---|
| PubChem CID | 108502630 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N'-(4-methoxyphenyl)oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C13H16N2O5S/c1-20-11-4-2-9(3-5-11)14-12(16)13(17)15-10-6-7-21(18,19)8-10/h2-5,10H,6-8H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | OSQVSKVUDASQTA-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|