C15H20N2O4S — CID 113215603
1-(1,1-dioxothiolan-3-yl)-3-[1-(4-methoxyphenyl)cyclopropyl]urea (PubChem CID 113215603) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-[1-(4-methoxyphenyl)cyclopropyl]urea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-[1-(4-methoxyphenyl)cyclopropyl]urea |
|---|---|
| PubChem CID | 113215603 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-[1-(4-methoxyphenyl)cyclopropyl]urea |
| SMILES | COc1ccc(C2(NC(=O)NC3CCS(=O)(=O)C3)CC2)cc1 |
| InChI | InChI=1S/C15H20N2O4S/c1-21-13-4-2-11(3-5-13)15(7-8-15)17-14(18)16-12-6-9-22(19,20)10-12/h2-5,12H,6-10H2,1H3,(H2,16,17,18) |
| InChIKey | AYOJGXGFNVZDQC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |