C15H19FN2O3S — CID 95307173
1-[(3R)-1,1-dioxothiolan-3-yl]-3-[1-(4-fluorophenyl)cyclobutyl]urea (PubChem CID 95307173) has the molecular formula C15H19FN2O3S and a molecular weight of 326.39 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[1-(4-fluorophenyl)cyclobutyl]urea.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[1-(4-fluorophenyl)cyclobutyl]urea |
|---|---|
| PubChem CID | 95307173 |
| Molecular Formula | C15H19FN2O3S |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[1-(4-fluorophenyl)cyclobutyl]urea |
| SMILES | O=C(N[C@@H]1CCS(=O)(=O)C1)NC1(c2ccc(F)cc2)CCC1 |
| InChI | InChI=1S/C15H19FN2O3S/c16-12-4-2-11(3-5-12)15(7-1-8-15)18-14(19)17-13-6-9-22(20,21)10-13/h2-5,13H,1,6-10H2,(H2,17,18,19)/t13-/m1/s1 |
| InChIKey | RTWNDDYSEZWTEO-CYBMUJFWSA-N |
| XLogP | 1.69 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |