C11H18N2O5S — CID 79845778
2-[1-[(1,1-dioxothiolan-3-yl)carbamoylamino]cyclobutyl]acetic acid (PubChem CID 79845778) has the molecular formula C11H18N2O5S and a molecular weight of 290.34 g/mol. Its IUPAC name is 2-[1-[(1,1-dioxothiolan-3-yl)carbamoylamino]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[(1,1-dioxothiolan-3-yl)carbamoylamino]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 79845778 |
| Molecular Formula | C11H18N2O5S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-[1-[(1,1-dioxothiolan-3-yl)carbamoylamino]cyclobutyl]acetic acid |
| SMILES | O=C(O)CC1(NC(=O)NC2CCS(=O)(=O)C2)CCC1 |
| InChI | InChI=1S/C11H18N2O5S/c14-9(15)6-11(3-1-4-11)13-10(16)12-8-2-5-19(17,18)7-8/h8H,1-7H2,(H,14,15)(H2,12,13,16) |
| InChIKey | XPTDXRBDXSMVDC-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |