C9H13NO5S — CID 62095028
1-[(1,1-dioxothiolan-3-yl)carbamoyl]cyclopropane-1-carboxylic acid (PubChem CID 62095028) has the molecular formula C9H13NO5S and a molecular weight of 247.27 g/mol. Its IUPAC name is 1-[(1,1-dioxothiolan-3-yl)carbamoyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[(1,1-dioxothiolan-3-yl)carbamoyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 62095028 |
| Molecular Formula | C9H13NO5S |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 1-[(1,1-dioxothiolan-3-yl)carbamoyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(C(=O)NC2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C9H13NO5S/c11-7(9(2-3-9)8(12)13)10-6-1-4-16(14,15)5-6/h6H,1-5H2,(H,10,11)(H,12,13) |
| InChIKey | WXMFBVTXNQDPBC-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|