C13H22N2O4S — CID 108971407
1-N'-butan-2-yl-1-N-(1,1-dioxothiolan-3-yl)cyclopropane-1,1-dicarboxamide (PubChem CID 108971407) has the molecular formula C13H22N2O4S and a molecular weight of 302.40 g/mol. Its IUPAC name is 1-N'-butan-2-yl-1-N-(1,1-dioxothiolan-3-yl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-butan-2-yl-1-N-(1,1-dioxothiolan-3-yl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108971407 |
| Molecular Formula | C13H22N2O4S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1-N'-butan-2-yl-1-N-(1,1-dioxothiolan-3-yl)cyclopropane-1,1-dicarboxamide |
| SMILES | CCC(C)NC(=O)C1(C(=O)NC2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C13H22N2O4S/c1-3-9(2)14-11(16)13(5-6-13)12(17)15-10-4-7-20(18,19)8-10/h9-10H,3-8H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | CGIGSTATYZJPSF-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|