C9H15N3O4S — CID 80591007
N-(1,1-dioxothiolan-3-yl)-1-(N'-hydroxycarbamimidoyl)cyclopropane-1-carboxamide (PubChem CID 80591007) has the molecular formula C9H15N3O4S and a molecular weight of 261.30 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-1-(N'-hydroxycarbamimidoyl)cyclopropane-1-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-1-(N'-hydroxycarbamimidoyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 80591007 |
| Molecular Formula | C9H15N3O4S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-1-(N'-hydroxycarbamimidoyl)cyclopropane-1-carboxamide |
| SMILES | NC(=NO)C1(C(=O)NC2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C9H15N3O4S/c10-7(12-14)9(2-3-9)8(13)11-6-1-4-17(15,16)5-6/h6,14H,1-5H2,(H2,10,12)(H,11,13) |
| InChIKey | YPBLDTHKMNINNF-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 121.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|