C15H28N4O2 — CID 76919669
1-(N'-hydroxycarbamimidoyl)-N-(1-methylpiperidin-4-yl)cycloheptane-1-carboxamide (PubChem CID 76919669) has the molecular formula C15H28N4O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 1-(N'-hydroxycarbamimidoyl)-N-(1-methylpiperidin-4-yl)cycloheptane-1-carboxamide.
| Compound Name | 1-(N'-hydroxycarbamimidoyl)-N-(1-methylpiperidin-4-yl)cycloheptane-1-carboxamide |
|---|---|
| PubChem CID | 76919669 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | 1-(N'-hydroxycarbamimidoyl)-N-(1-methylpiperidin-4-yl)cycloheptane-1-carboxamide |
| SMILES | CN1CCC(NC(=O)C2(C(N)=NO)CCCCCC2)CC1 |
| InChI | InChI=1S/C15H28N4O2/c1-19-10-6-12(7-11-19)17-14(20)15(13(16)18-21)8-4-2-3-5-9-15/h12,21H,2-11H2,1H3,(H2,16,18)(H,17,20) |
| InChIKey | PZOWGNHTHKFZAQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|