C8H13N3O2 — CID 80590677
N-cyclopropyl-1-(N'-hydroxycarbamimidoyl)cyclopropane-1-carboxamide (PubChem CID 80590677) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is N-cyclopropyl-1-(N'-hydroxycarbamimidoyl)cyclopropane-1-carboxamide.
| Compound Name | N-cyclopropyl-1-(N'-hydroxycarbamimidoyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 80590677 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | N-cyclopropyl-1-(N'-hydroxycarbamimidoyl)cyclopropane-1-carboxamide |
| SMILES | NC(=NO)C1(C(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C8H13N3O2/c9-6(11-13)8(3-4-8)7(12)10-5-1-2-5/h5,13H,1-4H2,(H2,9,11)(H,10,12) |
| InChIKey | JTHPFNPWQRPEHL-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|