C15H21N3O4S — CID 109094612
6-N-butan-2-yl-2-N-(1,1-dioxothiolan-3-yl)pyridine-2,6-dicarboxamide (PubChem CID 109094612) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is 6-N-butan-2-yl-2-N-(1,1-dioxothiolan-3-yl)pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-butan-2-yl-2-N-(1,1-dioxothiolan-3-yl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109094612 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 6-N-butan-2-yl-2-N-(1,1-dioxothiolan-3-yl)pyridine-2,6-dicarboxamide |
| SMILES | CCC(C)NC(=O)c1cccc(C(=O)NC2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C15H21N3O4S/c1-3-10(2)16-14(19)12-5-4-6-13(18-12)15(20)17-11-7-8-23(21,22)9-11/h4-6,10-11H,3,7-9H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | SHANQTIYHCBHQJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |