C16H18N2O3S2 — CID 17398664
N-(1,1-dioxothiolan-3-yl)-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 17398664) has the molecular formula C16H18N2O3S2 and a molecular weight of 350.47 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 17398664 |
| Molecular Formula | C16H18N2O3S2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(4-ethylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | CCc1ccc(-c2nc(C(=O)NC3CCS(=O)(=O)C3)cs2)cc1 |
| InChI | InChI=1S/C16H18N2O3S2/c1-2-11-3-5-12(6-4-11)16-18-14(9-22-16)15(19)17-13-7-8-23(20,21)10-13/h3-6,9,13H,2,7-8,10H2,1H3,(H,17,19) |
| InChIKey | ICRQSOKWMWFAFR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |