C17H20N4O4S2 — CID 41131411
1-[(3R)-1,1-dioxothiolan-3-yl]-3-[[2-(4-ethylphenyl)-1,3-thiazole-4-carbonyl]amino]urea (PubChem CID 41131411) has the molecular formula C17H20N4O4S2 and a molecular weight of 408.51 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[[2-(4-ethylphenyl)-1,3-thiazole-4-carbonyl]amino]urea.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[[2-(4-ethylphenyl)-1,3-thiazole-4-carbonyl]amino]urea |
|---|---|
| PubChem CID | 41131411 |
| Molecular Formula | C17H20N4O4S2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[[2-(4-ethylphenyl)-1,3-thiazole-4-carbonyl]amino]urea |
| SMILES | CCc1ccc(-c2nc(C(=O)NNC(=O)N[C@@H]3CCS(=O)(=O)C3)cs2)cc1 |
| InChI | InChI=1S/C17H20N4O4S2/c1-2-11-3-5-12(6-4-11)16-19-14(9-26-16)15(22)20-21-17(23)18-13-7-8-27(24,25)10-13/h3-6,9,13H,2,7-8,10H2,1H3,(H,20,22)(H2,18,21,23)/t13-/m1/s1 |
| InChIKey | SJUCJGFXDQASOP-CYBMUJFWSA-N |
| XLogP | 1.50 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|