C13H18N2O3S — CID 146125648
N-(1,1-dioxothian-4-yl)-4-ethylpyridine-2-carboxamide (PubChem CID 146125648) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-4-ethylpyridine-2-carboxamide.
| Compound Name | N-(1,1-dioxothian-4-yl)-4-ethylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 146125648 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-4-ethylpyridine-2-carboxamide |
| SMILES | CCc1ccnc(C(=O)NC2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C13H18N2O3S/c1-2-10-3-6-14-12(9-10)13(16)15-11-4-7-19(17,18)8-5-11/h3,6,9,11H,2,4-5,7-8H2,1H3,(H,15,16) |
| InChIKey | CSHDLFFEUZVXOS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |