C16H24N4O4S — CID 109084031
2-N-[3-(dimethylamino)propyl]-4-N-(1,1-dioxothiolan-3-yl)pyridine-2,4-dicarboxamide (PubChem CID 109084031) has the molecular formula C16H24N4O4S and a molecular weight of 368.46 g/mol. Its IUPAC name is 2-N-[3-(dimethylamino)propyl]-4-N-(1,1-dioxothiolan-3-yl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-[3-(dimethylamino)propyl]-4-N-(1,1-dioxothiolan-3-yl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109084031 |
| Molecular Formula | C16H24N4O4S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 2-N-[3-(dimethylamino)propyl]-4-N-(1,1-dioxothiolan-3-yl)pyridine-2,4-dicarboxamide |
| SMILES | CN(C)CCCNC(=O)c1cc(C(=O)NC2CCS(=O)(=O)C2)ccn1 |
| InChI | InChI=1S/C16H24N4O4S/c1-20(2)8-3-6-18-16(22)14-10-12(4-7-17-14)15(21)19-13-5-9-25(23,24)11-13/h4,7,10,13H,3,5-6,8-9,11H2,1-2H3,(H,18,22)(H,19,21) |
| InChIKey | KOLPEBUHZGRDQE-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|