C17H24N2O4S — CID 109055570
3-N-(1,1-dioxothiolan-3-yl)-1-N-pentylbenzene-1,3-dicarboxamide (PubChem CID 109055570) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is 3-N-(1,1-dioxothiolan-3-yl)-1-N-pentylbenzene-1,3-dicarboxamide.
| Compound Name | 3-N-(1,1-dioxothiolan-3-yl)-1-N-pentylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109055570 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 3-N-(1,1-dioxothiolan-3-yl)-1-N-pentylbenzene-1,3-dicarboxamide |
| SMILES | CCCCCNC(=O)c1cccc(C(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C17H24N2O4S/c1-2-3-4-9-18-16(20)13-6-5-7-14(11-13)17(21)19-15-8-10-24(22,23)12-15/h5-7,11,15H,2-4,8-10,12H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | KVKGFYHKAADDKQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|