C18H19NO3S — CID 95741050
N-[(3S)-1,1-dioxothiolan-3-yl]-3-(3-methylphenyl)benzamide (PubChem CID 95741050) has the molecular formula C18H19NO3S and a molecular weight of 329.42 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-3-(3-methylphenyl)benzamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-3-(3-methylphenyl)benzamide |
|---|---|
| PubChem CID | 95741050 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-3-(3-methylphenyl)benzamide |
| SMILES | Cc1cccc(-c2cccc(C(=O)N[C@H]3CCS(=O)(=O)C3)c2)c1 |
| InChI | InChI=1S/C18H19NO3S/c1-13-4-2-5-14(10-13)15-6-3-7-16(11-15)18(20)19-17-8-9-23(21,22)12-17/h2-7,10-11,17H,8-9,12H2,1H3,(H,19,20)/t17-/m0/s1 |
| InChIKey | RTMFLYRFRCYVNA-KRWDZBQOSA-N |
| XLogP | 2.58 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |