C17H17NO4S2 — CID 121499202
3-(2-acetylthiophen-3-yl)-N-(1,1-dioxothiolan-3-yl)benzamide (PubChem CID 121499202) has the molecular formula C17H17NO4S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 3-(2-acetylthiophen-3-yl)-N-(1,1-dioxothiolan-3-yl)benzamide.
| Compound Name | 3-(2-acetylthiophen-3-yl)-N-(1,1-dioxothiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 121499202 |
| Molecular Formula | C17H17NO4S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 3-(2-acetylthiophen-3-yl)-N-(1,1-dioxothiolan-3-yl)benzamide |
| SMILES | CC(=O)c1sccc1-c1cccc(C(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C17H17NO4S2/c1-11(19)16-15(5-7-23-16)12-3-2-4-13(9-12)17(20)18-14-6-8-24(21,22)10-14/h2-5,7,9,14H,6,8,10H2,1H3,(H,18,20) |
| InChIKey | KUDCGDPYVLRSGM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |