C15H15NO3S2 — CID 95574609
N-[(3S)-1,1-dioxothiolan-3-yl]-3-phenylthiophene-2-carboxamide (PubChem CID 95574609) has the molecular formula C15H15NO3S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-3-phenylthiophene-2-carboxamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-3-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 95574609 |
| Molecular Formula | C15H15NO3S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-3-phenylthiophene-2-carboxamide |
| SMILES | O=C(N[C@H]1CCS(=O)(=O)C1)c1sccc1-c1ccccc1 |
| InChI | InChI=1S/C15H15NO3S2/c17-15(16-12-7-9-21(18,19)10-12)14-13(6-8-20-14)11-4-2-1-3-5-11/h1-6,8,12H,7,9-10H2,(H,16,17)/t12-/m0/s1 |
| InChIKey | FTZXFDUHYQOUCK-LBPRGKRZSA-N |
| XLogP | 2.33 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |