C16H17NO3S2 — CID 125418912
N-[(3S)-1,1-dioxothiolan-3-yl]-4-methyl-5-phenylthiophene-2-carboxamide (PubChem CID 125418912) has the molecular formula C16H17NO3S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-4-methyl-5-phenylthiophene-2-carboxamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-4-methyl-5-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 125418912 |
| Molecular Formula | C16H17NO3S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-4-methyl-5-phenylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@H]2CCS(=O)(=O)C2)sc1-c1ccccc1 |
| InChI | InChI=1S/C16H17NO3S2/c1-11-9-14(21-15(11)12-5-3-2-4-6-12)16(18)17-13-7-8-22(19,20)10-13/h2-6,9,13H,7-8,10H2,1H3,(H,17,18)/t13-/m0/s1 |
| InChIKey | WYMGVBDMUGTADX-ZDUSSCGKSA-N |
| XLogP | 2.64 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |