C15H21NO3S2 — CID 27710092
N-[(3S)-1,1-dioxothiolan-3-yl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide (PubChem CID 27710092) has the molecular formula C15H21NO3S2 and a molecular weight of 327.47 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 27710092 |
| Molecular Formula | C15H21NO3S2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide |
| SMILES | O=C(N[C@H]1CCS(=O)(=O)C1)c1cc2c(s1)CCCCCC2 |
| InChI | InChI=1S/C15H21NO3S2/c17-15(16-12-7-8-21(18,19)10-12)14-9-11-5-3-1-2-4-6-13(11)20-14/h9,12H,1-8,10H2,(H,16,17)/t12-/m0/s1 |
| InChIKey | ZLLHVFJCJFSPHW-LBPRGKRZSA-N |
| XLogP | 2.32 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |