C13H16ClNO3S2 — CID 78910762
N-(4-chloro-1,1-dioxothiolan-3-yl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 78910762) has the molecular formula C13H16ClNO3S2 and a molecular weight of 333.86 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 78910762 |
| Molecular Formula | C13H16ClNO3S2 |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC1CS(=O)(=O)CC1Cl)c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C13H16ClNO3S2/c14-9-6-20(17,18)7-10(9)15-13(16)12-5-8-3-1-2-4-11(8)19-12/h5,9-10H,1-4,6-7H2,(H,15,16) |
| InChIKey | OBKQOFOKJSLISU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|