C17H23NO3S — CID 120678419
cis-(1R,3S)-3-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonylamino)cyclopentane-1-carboxylic acid (PubChem CID 120678419) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is cis-(1R,3S)-3-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonylamino)cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 120678419 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | cis-(1R,3S)-3-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonylamino)cyclopentane-1-carboxylic acid |
| SMILES | O=C(N[C@H]1CC[C@@H](C(=O)O)C1)c1cc2c(s1)CCCCCC2 |
| InChI | InChI=1S/C17H23NO3S/c19-16(18-13-8-7-12(9-13)17(20)21)15-10-11-5-3-1-2-4-6-14(11)22-15/h10,12-13H,1-9H2,(H,18,19)(H,20,21)/t12-,13+/m1/s1 |
| InChIKey | LLHVFLVLBVMULE-OLZOCXBDSA-N |
| XLogP | 3.39 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |