C19H21NOS — CID 55339840
N-(1,2,3,4-tetrahydronaphthalen-2-yl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 55339840) has the molecular formula C19H21NOS and a molecular weight of 311.45 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydronaphthalen-2-yl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(1,2,3,4-tetrahydronaphthalen-2-yl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 55339840 |
| Molecular Formula | C19H21NOS |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-(1,2,3,4-tetrahydronaphthalen-2-yl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC1CCc2ccccc2C1)c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C19H21NOS/c21-19(18-12-15-7-3-4-8-17(15)22-18)20-16-10-9-13-5-1-2-6-14(13)11-16/h1-2,5-6,12,16H,3-4,7-11H2,(H,20,21) |
| InChIKey | RWCPMOXZEGRTAS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |