C18H21FN2OS — CID 119477809
N-(4-aminocyclohexyl)-5-(4-fluorophenyl)-4-methylthiophene-2-carboxamide (PubChem CID 119477809) has the molecular formula C18H21FN2OS and a molecular weight of 332.44 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-5-(4-fluorophenyl)-4-methylthiophene-2-carboxamide.
| Compound Name | N-(4-aminocyclohexyl)-5-(4-fluorophenyl)-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 119477809 |
| Molecular Formula | C18H21FN2OS |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | N-(4-aminocyclohexyl)-5-(4-fluorophenyl)-4-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NC2CCC(N)CC2)sc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H21FN2OS/c1-11-10-16(18(22)21-15-8-6-14(20)7-9-15)23-17(11)12-2-4-13(19)5-3-12/h2-5,10,14-15H,6-9,20H2,1H3,(H,21,22) |
| InChIKey | ULLNSPKGSGRNHF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |