C10H13NO3S2 — CID 30789391
N-[(3S)-1,1-dioxothiolan-3-yl]-3-methylthiophene-2-carboxamide (PubChem CID 30789391) has the molecular formula C10H13NO3S2 and a molecular weight of 259.35 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-3-methylthiophene-2-carboxamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 30789391 |
| Molecular Formula | C10H13NO3S2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-3-methylthiophene-2-carboxamide |
| SMILES | Cc1ccsc1C(=O)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H13NO3S2/c1-7-2-4-15-9(7)10(12)11-8-3-5-16(13,14)6-8/h2,4,8H,3,5-6H2,1H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | NZTZOJLCKOXPSK-QMMMGPOBSA-N |
| XLogP | 0.97 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |