C16H17NO3S2 — CID 60511869
N-(1,1-dioxothian-4-yl)-3-phenylthiophene-2-carboxamide (PubChem CID 60511869) has the molecular formula C16H17NO3S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-3-phenylthiophene-2-carboxamide.
| Compound Name | N-(1,1-dioxothian-4-yl)-3-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 60511869 |
| Molecular Formula | C16H17NO3S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-3-phenylthiophene-2-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)CC1)c1sccc1-c1ccccc1 |
| InChI | InChI=1S/C16H17NO3S2/c18-16(17-13-7-10-22(19,20)11-8-13)15-14(6-9-21-15)12-4-2-1-3-5-12/h1-6,9,13H,7-8,10-11H2,(H,17,18) |
| InChIKey | MTGHBSHDMLKVEC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |