C17H21ClN2OS — CID 119603142
N-[2-(aminomethyl)cyclopentyl]-3-phenylthiophene-2-carboxamide;hydrochloride (PubChem CID 119603142) has the molecular formula C17H21ClN2OS and a molecular weight of 336.89 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-3-phenylthiophene-2-carboxamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-3-phenylthiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119603142 |
| Molecular Formula | C17H21ClN2OS |
| Molecular Weight | 336.89 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-3-phenylthiophene-2-carboxamide;hydrochloride |
| SMILES | Cl.NCC1CCCC1NC(=O)c1sccc1-c1ccccc1 |
| InChI | InChI=1S/C17H20N2OS.ClH/c18-11-13-7-4-8-15(13)19-17(20)16-14(9-10-21-16)12-5-2-1-3-6-12;/h1-3,5-6,9-10,13,15H,4,7-8,11,18H2,(H,19,20);1H |
| InChIKey | PTHMRVQANTZWJP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.89 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |