C11H13NO5S — CID 103749000
N-(1,1-dioxothiolan-3-yl)-2,6-dihydroxybenzamide (PubChem CID 103749000) has the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2,6-dihydroxybenzamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2,6-dihydroxybenzamide |
|---|---|
| PubChem CID | 103749000 |
| Molecular Formula | C11H13NO5S |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2,6-dihydroxybenzamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1c(O)cccc1O |
| InChI | InChI=1S/C11H13NO5S/c13-8-2-1-3-9(14)10(8)11(15)12-7-4-5-18(16,17)6-7/h1-3,7,13-14H,4-6H2,(H,12,15) |
| InChIKey | PPVVPUYGQAOOSQ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |