C12H13NO3 — CID 103890634
N-cyclopent-3-en-1-yl-2,6-dihydroxybenzamide (PubChem CID 103890634) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is N-cyclopent-3-en-1-yl-2,6-dihydroxybenzamide.
| Compound Name | N-cyclopent-3-en-1-yl-2,6-dihydroxybenzamide |
|---|---|
| PubChem CID | 103890634 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | N-cyclopent-3-en-1-yl-2,6-dihydroxybenzamide |
| SMILES | O=C(NC1CC=CC1)c1c(O)cccc1O |
| InChI | InChI=1S/C12H13NO3/c14-9-6-3-7-10(15)11(9)12(16)13-8-4-1-2-5-8/h1-3,6-8,14-15H,4-5H2,(H,13,16) |
| InChIKey | ZLBUKHKGOKOIHK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|