C13H15NO5 — CID 107688102
3-[(2,6-dihydroxybenzoyl)amino]cyclopentane-1-carboxylic acid (PubChem CID 107688102) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is 3-[(2,6-dihydroxybenzoyl)amino]cyclopentane-1-carboxylic acid.
| Compound Name | 3-[(2,6-dihydroxybenzoyl)amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 107688102 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 3-[(2,6-dihydroxybenzoyl)amino]cyclopentane-1-carboxylic acid |
| SMILES | O=C(NC1CCC(C(=O)O)C1)c1c(O)cccc1O |
| InChI | InChI=1S/C13H15NO5/c15-9-2-1-3-10(16)11(9)12(17)14-8-5-4-7(6-8)13(18)19/h1-3,7-8,15-16H,4-6H2,(H,14,17)(H,18,19) |
| InChIKey | VRTXMEPXNHAAPK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |