C14H18N2O3 — CID 107690219
N-(8-azabicyclo[3.2.1]octan-3-yl)-2,6-dihydroxybenzamide (PubChem CID 107690219) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-2,6-dihydroxybenzamide.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-2,6-dihydroxybenzamide |
|---|---|
| PubChem CID | 107690219 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-2,6-dihydroxybenzamide |
| SMILES | O=C(NC1CC2CCC(C1)N2)c1c(O)cccc1O |
| InChI | InChI=1S/C14H18N2O3/c17-11-2-1-3-12(18)13(11)14(19)16-10-6-8-4-5-9(7-10)15-8/h1-3,8-10,15,17-18H,4-7H2,(H,16,19) |
| InChIKey | OVLQEKDMDYCFDU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |