C18H19N3O4S — CID 109098728
6-N-(1,1-dioxothiolan-3-yl)-2-N-(4-methylphenyl)pyridine-2,6-dicarboxamide (PubChem CID 109098728) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is 6-N-(1,1-dioxothiolan-3-yl)-2-N-(4-methylphenyl)pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-(1,1-dioxothiolan-3-yl)-2-N-(4-methylphenyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109098728 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 6-N-(1,1-dioxothiolan-3-yl)-2-N-(4-methylphenyl)pyridine-2,6-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(C(=O)NC3CCS(=O)(=O)C3)n2)cc1 |
| InChI | InChI=1S/C18H19N3O4S/c1-12-5-7-13(8-6-12)19-17(22)15-3-2-4-16(21-15)18(23)20-14-9-10-26(24,25)11-14/h2-8,14H,9-11H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | OYDGKDXSNMECLH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |