C9H11N3O3S — CID 110852783
N-(1,1-dioxothiolan-3-yl)pyridazine-3-carboxamide (PubChem CID 110852783) has the molecular formula C9H11N3O3S and a molecular weight of 241.27 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)pyridazine-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 110852783 |
| Molecular Formula | C9H11N3O3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)pyridazine-3-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1cccnn1 |
| InChI | InChI=1S/C9H11N3O3S/c13-9(8-2-1-4-10-12-8)11-7-3-5-16(14,15)6-7/h1-2,4,7H,3,5-6H2,(H,11,13) |
| InChIKey | LADLUZYKSWMKPN-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |