C12H18N4O4S — CID 109113749
N-(1,1-dioxothiolan-3-yl)-6-(2-methoxyethylamino)pyridazine-3-carboxamide (PubChem CID 109113749) has the molecular formula C12H18N4O4S and a molecular weight of 314.37 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-6-(2-methoxyethylamino)pyridazine-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-6-(2-methoxyethylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109113749 |
| Molecular Formula | C12H18N4O4S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-6-(2-methoxyethylamino)pyridazine-3-carboxamide |
| SMILES | COCCNc1ccc(C(=O)NC2CCS(=O)(=O)C2)nn1 |
| InChI | InChI=1S/C12H18N4O4S/c1-20-6-5-13-11-3-2-10(15-16-11)12(17)14-9-4-7-21(18,19)8-9/h2-3,9H,4-8H2,1H3,(H,13,16)(H,14,17) |
| InChIKey | MJLCGQDBTYWOEU-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|