C15H14F2N4O3S — CID 109122922
6-(3,4-difluoroanilino)-N-(1,1-dioxothiolan-3-yl)pyridazine-3-carboxamide (PubChem CID 109122922) has the molecular formula C15H14F2N4O3S and a molecular weight of 368.37 g/mol. Its IUPAC name is 6-(3,4-difluoroanilino)-N-(1,1-dioxothiolan-3-yl)pyridazine-3-carboxamide.
| Compound Name | 6-(3,4-difluoroanilino)-N-(1,1-dioxothiolan-3-yl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109122922 |
| Molecular Formula | C15H14F2N4O3S |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 6-(3,4-difluoroanilino)-N-(1,1-dioxothiolan-3-yl)pyridazine-3-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1ccc(Nc2ccc(F)c(F)c2)nn1 |
| InChI | InChI=1S/C15H14F2N4O3S/c16-11-2-1-9(7-12(11)17)18-14-4-3-13(20-21-14)15(22)19-10-5-6-25(23,24)8-10/h1-4,7,10H,5-6,8H2,(H,18,21)(H,19,22) |
| InChIKey | OWHXPAGMTZCUIG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |