C16H15F2N3O3S — CID 113028644
N-[5-[(1,1-dioxothiolan-3-yl)amino]-2-pyridinyl]-3,4-difluorobenzamide (PubChem CID 113028644) has the molecular formula C16H15F2N3O3S and a molecular weight of 367.38 g/mol. Its IUPAC name is N-[5-[(1,1-dioxothiolan-3-yl)amino]-2-pyridinyl]-3,4-difluorobenzamide.
| Compound Name | N-[5-[(1,1-dioxothiolan-3-yl)amino]-2-pyridinyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 113028644 |
| Molecular Formula | C16H15F2N3O3S |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | N-[5-[(1,1-dioxothiolan-3-yl)amino]-2-pyridinyl]-3,4-difluorobenzamide |
| SMILES | O=C(Nc1ccc(NC2CCS(=O)(=O)C2)cn1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H15F2N3O3S/c17-13-3-1-10(7-14(13)18)16(22)21-15-4-2-11(8-19-15)20-12-5-6-25(23,24)9-12/h1-4,7-8,12,20H,5-6,9H2,(H,19,21,22) |
| InChIKey | WUDOPFLDLRKZIC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |