C18H19F2N3O3S — CID 113014143
N-[6-[(1,1-dioxothiolan-3-yl)-ethylamino]-3-pyridinyl]-3,4-difluorobenzamide (PubChem CID 113014143) has the molecular formula C18H19F2N3O3S and a molecular weight of 395.43 g/mol. Its IUPAC name is N-[6-[(1,1-dioxothiolan-3-yl)-ethylamino]-3-pyridinyl]-3,4-difluorobenzamide.
| Compound Name | N-[6-[(1,1-dioxothiolan-3-yl)-ethylamino]-3-pyridinyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 113014143 |
| Molecular Formula | C18H19F2N3O3S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | N-[6-[(1,1-dioxothiolan-3-yl)-ethylamino]-3-pyridinyl]-3,4-difluorobenzamide |
| SMILES | CCN(c1ccc(NC(=O)c2ccc(F)c(F)c2)cn1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H19F2N3O3S/c1-2-23(14-7-8-27(25,26)11-14)17-6-4-13(10-21-17)22-18(24)12-3-5-15(19)16(20)9-12/h3-6,9-10,14H,2,7-8,11H2,1H3,(H,22,24) |
| InChIKey | OMDYKGLQFJJILM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |