C17H18FN3O3S — CID 113013680
N-[6-[(1,1-dioxothiolan-3-yl)-methylamino]-3-pyridinyl]-4-fluorobenzamide (PubChem CID 113013680) has the molecular formula C17H18FN3O3S and a molecular weight of 363.41 g/mol. Its IUPAC name is N-[6-[(1,1-dioxothiolan-3-yl)-methylamino]-3-pyridinyl]-4-fluorobenzamide.
| Compound Name | N-[6-[(1,1-dioxothiolan-3-yl)-methylamino]-3-pyridinyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 113013680 |
| Molecular Formula | C17H18FN3O3S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | N-[6-[(1,1-dioxothiolan-3-yl)-methylamino]-3-pyridinyl]-4-fluorobenzamide |
| SMILES | CN(c1ccc(NC(=O)c2ccc(F)cc2)cn1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H18FN3O3S/c1-21(15-8-9-25(23,24)11-15)16-7-6-14(10-19-16)20-17(22)12-2-4-13(18)5-3-12/h2-7,10,15H,8-9,11H2,1H3,(H,20,22) |
| InChIKey | WGMBNOHWQZCHIP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |