C17H26N4O3S — CID 113013709
1-cyclohexyl-3-[6-[(1,1-dioxothiolan-3-yl)-methylamino]-3-pyridinyl]urea (PubChem CID 113013709) has the molecular formula C17H26N4O3S and a molecular weight of 366.49 g/mol. Its IUPAC name is 1-cyclohexyl-3-[6-[(1,1-dioxothiolan-3-yl)-methylamino]-3-pyridinyl]urea.
| Compound Name | 1-cyclohexyl-3-[6-[(1,1-dioxothiolan-3-yl)-methylamino]-3-pyridinyl]urea |
|---|---|
| PubChem CID | 113013709 |
| Molecular Formula | C17H26N4O3S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-cyclohexyl-3-[6-[(1,1-dioxothiolan-3-yl)-methylamino]-3-pyridinyl]urea |
| SMILES | CN(c1ccc(NC(=O)NC2CCCCC2)cn1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H26N4O3S/c1-21(15-9-10-25(23,24)12-15)16-8-7-14(11-18-16)20-17(22)19-13-5-3-2-4-6-13/h7-8,11,13,15H,2-6,9-10,12H2,1H3,(H2,19,20,22) |
| InChIKey | LHJJYARDYKFEDG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |