C15H23N3O3S — CID 113013666
N-[6-[(1,1-dioxothiolan-3-yl)-methylamino]-3-pyridinyl]pentanamide (PubChem CID 113013666) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is N-[6-[(1,1-dioxothiolan-3-yl)-methylamino]-3-pyridinyl]pentanamide.
| Compound Name | N-[6-[(1,1-dioxothiolan-3-yl)-methylamino]-3-pyridinyl]pentanamide |
|---|---|
| PubChem CID | 113013666 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | N-[6-[(1,1-dioxothiolan-3-yl)-methylamino]-3-pyridinyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc(N(C)C2CCS(=O)(=O)C2)nc1 |
| InChI | InChI=1S/C15H23N3O3S/c1-3-4-5-15(19)17-12-6-7-14(16-10-12)18(2)13-8-9-22(20,21)11-13/h6-7,10,13H,3-5,8-9,11H2,1-2H3,(H,17,19) |
| InChIKey | AYEXGGKLMASUML-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |