C16H26N4O3S — CID 109154402
N-[3-(dimethylamino)propyl]-6-[(1,1-dioxothiolan-3-yl)-methylamino]pyridine-3-carboxamide (PubChem CID 109154402) has the molecular formula C16H26N4O3S and a molecular weight of 354.48 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-6-[(1,1-dioxothiolan-3-yl)-methylamino]pyridine-3-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-6-[(1,1-dioxothiolan-3-yl)-methylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109154402 |
| Molecular Formula | C16H26N4O3S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-6-[(1,1-dioxothiolan-3-yl)-methylamino]pyridine-3-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1ccc(N(C)C2CCS(=O)(=O)C2)nc1 |
| InChI | InChI=1S/C16H26N4O3S/c1-19(2)9-4-8-17-16(21)13-5-6-15(18-11-13)20(3)14-7-10-24(22,23)12-14/h5-6,11,14H,4,7-10,12H2,1-3H3,(H,17,21) |
| InChIKey | GGADIHMINPDBCZ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|