C13H18N4O3S — CID 109110428
6-[(1,1-dioxothiolan-3-yl)-methylamino]-N-prop-2-enylpyridazine-3-carboxamide (PubChem CID 109110428) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is 6-[(1,1-dioxothiolan-3-yl)-methylamino]-N-prop-2-enylpyridazine-3-carboxamide.
| Compound Name | 6-[(1,1-dioxothiolan-3-yl)-methylamino]-N-prop-2-enylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109110428 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 6-[(1,1-dioxothiolan-3-yl)-methylamino]-N-prop-2-enylpyridazine-3-carboxamide |
| SMILES | C=CCNC(=O)c1ccc(N(C)C2CCS(=O)(=O)C2)nn1 |
| InChI | InChI=1S/C13H18N4O3S/c1-3-7-14-13(18)11-4-5-12(16-15-11)17(2)10-6-8-21(19,20)9-10/h3-5,10H,1,6-9H2,2H3,(H,14,18) |
| InChIKey | BGEUTLZLWKUSLN-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|